C15H27NO6 — CID 10757845
1-O,3-O-ditert-butyl 2-O-methyl (1S,2R)-1-aminopropane-1,2,3-tricarboxylate (PubChem CID 10757845) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-O,3-O-ditert-butyl 2-O-methyl (1S,2R)-1-aminopropane-1,2,3-tricarboxylate.
| Compound Name | 1-O,3-O-ditert-butyl 2-O-methyl (1S,2R)-1-aminopropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10757845 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-O,3-O-ditert-butyl 2-O-methyl (1S,2R)-1-aminopropane-1,2,3-tricarboxylate |
| SMILES | COC(=O)[C@H](CC(=O)OC(C)(C)C)[C@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO6/c1-14(2,3)21-10(17)8-9(12(18)20-7)11(16)13(19)22-15(4,5)6/h9,11H,8,16H2,1-7H3/t9-,11+/m1/s1 |
| InChIKey | SWAVQUCQHALXTR-KOLCDFICSA-N |
| XLogP | 1.18 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|