C13H26N2O4 — CID 154956810
ditert-butyl 2-amino-3-(aminomethyl)butanedioate (PubChem CID 154956810) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is ditert-butyl 2-amino-3-(aminomethyl)butanedioate.
| Compound Name | ditert-butyl 2-amino-3-(aminomethyl)butanedioate |
|---|---|
| PubChem CID | 154956810 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | ditert-butyl 2-amino-3-(aminomethyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)C(CN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-12(2,3)18-10(16)8(7-14)9(15)11(17)19-13(4,5)6/h8-9H,7,14-15H2,1-6H3 |
| InChIKey | VHBXIFOKBJHNOB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |