C19H33NO8 — CID 11761243
4-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butanedioate (PubChem CID 11761243) has the molecular formula C19H33NO8 and a molecular weight of 403.47 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 11761243 |
| Molecular Formula | C19H33NO8 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butanedioate |
| SMILES | COC(=O)[C@H](CC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO8/c1-17(2,3)26-13(21)11-12(14(22)25-10)20(15(23)27-18(4,5)6)16(24)28-19(7,8)9/h12H,11H2,1-10H3/t12-/m0/s1 |
| InChIKey | VGOVROMORBQMCD-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|