C17H30N2O9 — CID 11373137
methyl (2S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-hydroxy-6-nitrohexanoate (PubChem CID 11373137) has the molecular formula C17H30N2O9 and a molecular weight of 406.43 g/mol. Its IUPAC name is methyl (2S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-hydroxy-6-nitrohexanoate.
| Compound Name | methyl (2S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-hydroxy-6-nitrohexanoate |
|---|---|
| PubChem CID | 11373137 |
| Molecular Formula | C17H30N2O9 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | methyl (2S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-hydroxy-6-nitrohexanoate |
| SMILES | COC(=O)[C@H](CC[C@@H](O)C[N+](=O)[O-])N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O9/c1-16(2,3)27-14(22)19(15(23)28-17(4,5)6)12(13(21)26-7)9-8-11(20)10-18(24)25/h11-12,20H,8-10H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | GLNYIXXCRUVOAC-NEPJUHHUSA-N |
| XLogP | 2.12 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|