C16H29NO6S — CID 101154682
methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 101154682) has the molecular formula C16H29NO6S and a molecular weight of 363.48 g/mol. Its IUPAC name is methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 101154682 |
| Molecular Formula | C16H29NO6S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO6S/c1-15(2,3)22-13(19)17(14(20)23-16(4,5)6)11(9-10-24-8)12(18)21-7/h11H,9-10H2,1-8H3/t11-/m0/s1 |
| InChIKey | ZQCQBEJMOCZFDT-NSHDSACASA-N |
| XLogP | 3.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|