C26H34N4O5S — CID 15536820
methyl (2S)-2-[[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 15536820) has the molecular formula C26H34N4O5S and a molecular weight of 514.65 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 15536820 |
| Molecular Formula | C26H34N4O5S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | methyl (2S)-2-[[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)N(C(=O)OC(C)(C)C)C(=O)c1cccc(/N=N/c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C26H34N4O5S/c1-26(2,3)35-25(33)30(22(15-16-36-7)24(32)34-6)23(31)18-9-8-10-20(17-18)28-27-19-11-13-21(14-12-19)29(4)5/h8-14,17,22H,15-16H2,1-7H3/b28-27+/t22-/m0/s1 |
| InChIKey | FJHUKFNFSUMSFO-XJPNONJMSA-N |
| XLogP | 5.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|