C51H52N4O8 — CID 157153811
methyl 2-benzamido-3-(N-phenylanilino)propanoate;methyl 2-[benzoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-phenylanilino)propanoate (PubChem CID 157153811) has the molecular formula C51H52N4O8 and a molecular weight of 849.00 g/mol. Its IUPAC name is methyl 2-benzamido-3-(N-phenylanilino)propanoate;methyl 2-[benzoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-phenylanilino)propanoate.
| Compound Name | methyl 2-benzamido-3-(N-phenylanilino)propanoate;methyl 2-[benzoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-phenylanilino)propanoate |
|---|---|
| PubChem CID | 157153811 |
| Molecular Formula | C51H52N4O8 |
| Molecular Weight | 849.00 g/mol |
| Exact Mass | 848.38 |
| IUPAC Name | methyl 2-benzamido-3-(N-phenylanilino)propanoate;methyl 2-[benzoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-phenylanilino)propanoate |
| SMILES | COC(=O)C(CN(c1ccccc1)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)c1ccccc1.COC(=O)C(CN(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O5.C23H22N2O3/c1-28(2,3)35-27(33)30(25(31)21-14-8-5-9-15-21)24(26(32)34-4)20-29(22-16-10-6-11-17-22)23-18-12-7-13-19-23;1-28-23(27)21(24-22(26)18-11-5-2-6-12-18)17-25(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h5-19,24H,20H2,1-4H3;2-16,21H,17H2,1H3,(H,24,26) |
| InChIKey | ALOMOQMPZSOCGK-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.00 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|