C23H30N4O6 — CID 67504972
2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-pyrimidin-2-ylanilino)propanoic acid (PubChem CID 67504972) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-pyrimidin-2-ylanilino)propanoic acid.
| Compound Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-pyrimidin-2-ylanilino)propanoic acid |
|---|---|
| PubChem CID | 67504972 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(N-pyrimidin-2-ylanilino)propanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(CN(c1ccccc1)c1ncccn1)C(=O)O |
| InChI | InChI=1S/C23H30N4O6/c1-22(2,3)32-20(30)27(21(31)33-23(4,5)6)17(18(28)29)15-26(16-11-8-7-9-12-16)19-24-13-10-14-25-19/h7-14,17H,15H2,1-6H3,(H,28,29) |
| InChIKey | SGMGPTLPPJYEGB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |