C21H29NO8 — CID 11101928
2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 11101928) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 11101928 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(CC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H29NO8/c1-20(2,3)29-18(26)22(19(27)30-21(4,5)6)15(17(24)25)12-16(23)28-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,24,25) |
| InChIKey | HMCLQDDEIXDERR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|