C15H18N4 — CID 88745974
4-[[3-(aminomethyl)phenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 88745974) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-[[3-(aminomethyl)phenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[3-(aminomethyl)phenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 88745974 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-[[3-(aminomethyl)phenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2cccc(CN)c2)cc1 |
| InChI | InChI=1S/C15H18N4/c1-19(2)15-8-6-13(7-9-15)17-18-14-5-3-4-12(10-14)11-16/h3-10H,11,16H2,1-2H3/b18-17+ |
| InChIKey | VPKOOWBDUNCTMA-ISLYRVAYSA-N |
| XLogP | 3.63 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|