C16H22BrN5 — CID 122538081
4-[[1-(3-aminopropyl)pyridin-1-ium-4-yl]diazenyl]-N,N-dimethylaniline bromide (PubChem CID 122538081) has the molecular formula C16H22BrN5 and a molecular weight of 364.29 g/mol. Its IUPAC name is 4-[[1-(3-aminopropyl)pyridin-1-ium-4-yl]diazenyl]-N,N-dimethylaniline bromide.
| Compound Name | 4-[[1-(3-aminopropyl)pyridin-1-ium-4-yl]diazenyl]-N,N-dimethylaniline bromide |
|---|---|
| PubChem CID | 122538081 |
| Molecular Formula | C16H22BrN5 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[[1-(3-aminopropyl)pyridin-1-ium-4-yl]diazenyl]-N,N-dimethylaniline bromide |
| SMILES | CN(C)c1ccc(/N=N/c2cc[n+](CCCN)cc2)cc1.[Br-] |
| InChI | InChI=1S/C16H22N5.BrH/c1-20(2)16-6-4-14(5-7-16)18-19-15-8-12-21(13-9-15)11-3-10-17;/h4-9,12-13H,3,10-11,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WYPMLCLFDGFHSL-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|