C17H27N6+ — CID 122549887
4-[[1-(5-aminopentyl)-3-methylimidazol-3-ium-2-yl]diazenyl]-N,N-dimethylaniline (PubChem CID 122549887) has the molecular formula C17H27N6+ and a molecular weight of 315.45 g/mol. Its IUPAC name is 4-[[1-(5-aminopentyl)-3-methylimidazol-3-ium-2-yl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(5-aminopentyl)-3-methylimidazol-3-ium-2-yl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 122549887 |
| Molecular Formula | C17H27N6+ |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 4-[[1-(5-aminopentyl)-3-methylimidazol-3-ium-2-yl]diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2n(CCCCCN)cc[n+]2C)cc1 |
| InChI | InChI=1S/C17H27N6/c1-21(2)16-9-7-15(8-10-16)19-20-17-22(3)13-14-23(17)12-6-4-5-11-18/h7-10,13-14H,4-6,11-12,18H2,1-3H3/q+1 |
| InChIKey | KAZZJPYKAUOQFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|