C14H21ClN5+ — CID 143053640
chloromethane;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline (PubChem CID 143053640) has the molecular formula C14H21ClN5+ and a molecular weight of 294.81 g/mol. Its IUPAC name is chloromethane;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline.
| Compound Name | chloromethane;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143053640 |
| Molecular Formula | C14H21ClN5+ |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | chloromethane;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline |
| SMILES | CCl.CN(C)c1ccc(/N=N/c2n(C)cc[n+]2C)cc1 |
| InChI | InChI=1S/C13H18N5.CH3Cl/c1-16(2)12-7-5-11(6-8-12)14-15-13-17(3)9-10-18(13)4;1-2/h5-10H,1-4H3;1H3/q+1; |
| InChIKey | QDWCTDKWUFCVPI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|