C22H28N7+ — CID 59180987
4-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline (PubChem CID 59180987) has the molecular formula C22H28N7+ and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 59180987 |
| Molecular Formula | C22H28N7+ |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 4-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3n(C)cc[n+]3C)cc2)c(C)c1 |
| InChI | InChI=1S/C22H28N7/c1-6-29(7-2)20-12-13-21(17(3)16-20)25-23-18-8-10-19(11-9-18)24-26-22-27(4)14-15-28(22)5/h8-16H,6-7H2,1-5H3/q+1 |
| InChIKey | UOQLPCZRTPPQKB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 61.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|