C32H35N5 — CID 118655354
4-[[4-[[bis(4-methylphenyl)hydrazinylidene]methyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline (PubChem CID 118655354) has the molecular formula C32H35N5 and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-[[4-[[bis(4-methylphenyl)hydrazinylidene]methyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[[4-[[bis(4-methylphenyl)hydrazinylidene]methyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 118655354 |
| Molecular Formula | C32H35N5 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 4-[[4-[[bis(4-methylphenyl)hydrazinylidene]methyl]phenyl]diazenyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(C=NN(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C32H35N5/c1-6-36(7-2)31-20-21-32(26(5)22-31)35-34-28-14-12-27(13-15-28)23-33-37(29-16-8-24(3)9-17-29)30-18-10-25(4)11-19-30/h8-23H,6-7H2,1-5H3/b33-23?,35-34+ |
| InChIKey | RXKPEQNLNNXGQQ-VIALKSOWSA-N |
| XLogP | 9.05 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|