C40H47N7+2 — CID 59000102
N-benzyl-N-ethyl-3-methyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]aniline (PubChem CID 59000102) has the molecular formula C40H47N7+2 and a molecular weight of 625.87 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-methyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]aniline.
| Compound Name | N-benzyl-N-ethyl-3-methyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 59000102 |
| Molecular Formula | C40H47N7+2 |
| Molecular Weight | 625.87 g/mol |
| Exact Mass | 625.39 |
| IUPAC Name | N-benzyl-N-ethyl-3-methyl-4-[[1-[6-[4-[(Z)-[methyl(phenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]diazenyl]aniline |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2cc[n+](CCCCCC[n+]3ccc(/C=N\N(C)c4ccccc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C40H47N7/c1-4-47(33-36-15-9-7-10-16-36)39-19-20-40(34(2)31-39)43-42-37-23-29-46(30-24-37)26-14-6-5-13-25-45-27-21-35(22-28-45)32-41-44(3)38-17-11-8-12-18-38/h7-12,15-24,27-32H,4-6,13-14,25-26,33H2,1-3H3/q+2 |
| InChIKey | HLCNLVOKZLZGKL-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 51.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.87 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|