C22H28N5OS+ — CID 102058070
3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanamide (PubChem CID 102058070) has the molecular formula C22H28N5OS+ and a molecular weight of 410.57 g/mol. Its IUPAC name is 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanamide.
| Compound Name | 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanamide |
|---|---|
| PubChem CID | 102058070 |
| Molecular Formula | C22H28N5OS+ |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-methyl-1,3-benzothiazol-3-ium-3-yl]propanamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2sc3cc(C)ccc3[n+]2CCC(N)=O)c(C)c1 |
| InChI | InChI=1S/C22H27N5OS/c1-5-26(6-2)17-8-9-18(16(4)14-17)24-25-22-27(12-11-21(23)28)19-10-7-15(3)13-20(19)29-22/h7-10,13-14H,5-6,11-12H2,1-4H3,(H-,23,28)/p+1 |
| InChIKey | DBPFILPMUCNEPO-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|