C23H30ClN5O2S — CID 170839565
3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanimidate;hydrochloride (PubChem CID 170839565) has the molecular formula C23H30ClN5O2S and a molecular weight of 476.05 g/mol. Its IUPAC name is 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanimidate;hydrochloride.
| Compound Name | 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanimidate;hydrochloride |
|---|---|
| PubChem CID | 170839565 |
| Molecular Formula | C23H30ClN5O2S |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-[2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\[O-])CC[n+]1c(/N=N/c2ccc(N(CC)CC)cc2C)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C23H29N5O2S.ClH/c1-5-27(6-2)17-8-10-19(16(4)14-17)25-26-23-28(13-12-22(24)29)20-11-9-18(30-7-3)15-21(20)31-23;/h8-11,14-15H,5-7,12-13H2,1-4H3,(H-,24,29);1H |
| InChIKey | ZPSLSZDQBALUMU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|