C20H25N4OS+ — CID 20531309
4-[(3-butyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline (PubChem CID 20531309) has the molecular formula C20H25N4OS+ and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[(3-butyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(3-butyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 20531309 |
| Molecular Formula | C20H25N4OS+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[(3-butyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N,N-dimethylaniline |
| SMILES | CCCC[n+]1c(/N=N/c2ccc(N(C)C)cc2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C20H25N4OS/c1-5-6-13-24-18-12-11-17(25-4)14-19(18)26-20(24)22-21-15-7-9-16(10-8-15)23(2)3/h7-12,14H,5-6,13H2,1-4H3/q+1 |
| InChIKey | ZMYGPSZETKKLQU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|