C17H19N2OS+ — CID 58659961
4-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline (PubChem CID 58659961) has the molecular formula C17H19N2OS+ and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58659961 |
| Molecular Formula | C17H19N2OS+ |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2c(c1)sc(-c1ccc(N(C)C)cc1)[n+]2C |
| InChI | InChI=1S/C17H19N2OS/c1-18(2)13-7-5-12(6-8-13)17-19(3)15-10-9-14(20-4)11-16(15)21-17/h5-11H,1-4H3/q+1 |
| InChIKey | KYEWCXPNMLEVAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|