C19H20N5OS+ — CID 131699144
3-[4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-methylanilino]propanenitrile (PubChem CID 131699144) has the molecular formula C19H20N5OS+ and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-methylanilino]propanenitrile.
| Compound Name | 3-[4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 131699144 |
| Molecular Formula | C19H20N5OS+ |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]-N-methylanilino]propanenitrile |
| SMILES | COc1ccc2c(c1)sc(/N=N/c1ccc(N(C)CCC#N)cc1)[n+]2C |
| InChI | InChI=1S/C19H20N5OS/c1-23(12-4-11-20)15-7-5-14(6-8-15)21-22-19-24(2)17-10-9-16(25-3)13-18(17)26-19/h5-10,13H,4,12H2,1-3H3/q+1 |
| InChIKey | PFKDXKIIQFQLNH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|