C10H12INOS — CID 15374646
6-methoxy-2,3-dimethyl-1,3-benzothiazol-3-ium iodide (PubChem CID 15374646) has the molecular formula C10H12INOS and a molecular weight of 321.18 g/mol. Its IUPAC name is 6-methoxy-2,3-dimethyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 6-methoxy-2,3-dimethyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 15374646 |
| Molecular Formula | C10H12INOS |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 6-methoxy-2,3-dimethyl-1,3-benzothiazol-3-ium iodide |
| SMILES | COc1ccc2c(c1)sc(C)[n+]2C.[I-] |
| InChI | InChI=1S/C10H12NOS.HI/c1-7-11(2)9-5-4-8(12-3)6-10(9)13-7;/h4-6H,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZBNJDMZUCLBEBP-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|