C9H11NO4S2 — CID 12725856
2,3-dimethyl-1,3-benzothiazol-3-ium;hydrogen sulfate (PubChem CID 12725856) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-benzothiazol-3-ium;hydrogen sulfate.
| Compound Name | 2,3-dimethyl-1,3-benzothiazol-3-ium;hydrogen sulfate |
|---|---|
| PubChem CID | 12725856 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2,3-dimethyl-1,3-benzothiazol-3-ium;hydrogen sulfate |
| SMILES | Cc1sc2ccccc2[n+]1C.O=S(=O)([O-])O |
| InChI | InChI=1S/C9H10NS.H2O4S/c1-7-10(2)8-5-3-4-6-9(8)11-7;1-5(2,3)4/h3-6H,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | GETICZYAKZEVAK-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|