C10H9NO2S — CID 21043322
2,3-dimethyl-1,3-benzothiazol-3-ium-6-carboxylate (PubChem CID 21043322) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-benzothiazol-3-ium-6-carboxylate.
| Compound Name | 2,3-dimethyl-1,3-benzothiazol-3-ium-6-carboxylate |
|---|---|
| PubChem CID | 21043322 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2,3-dimethyl-1,3-benzothiazol-3-ium-6-carboxylate |
| SMILES | Cc1sc2cc(C(=O)[O-])ccc2[n+]1C |
| InChI | InChI=1S/C10H9NO2S/c1-6-11(2)8-4-3-7(10(12)13)5-9(8)14-6/h3-5H,1-2H3 |
| InChIKey | JRYGUTPUVASMCQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|