C16H8O8Ru — CID 88500443
bis(benzene-1,3-dicarboxylate);ruthenium(4+) (PubChem CID 88500443) has the molecular formula C16H8O8Ru and a molecular weight of 429.30 g/mol. Its IUPAC name is bis(benzene-1,3-dicarboxylate);ruthenium(4+).
| Compound Name | bis(benzene-1,3-dicarboxylate);ruthenium(4+) |
|---|---|
| PubChem CID | 88500443 |
| Molecular Formula | C16H8O8Ru |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | bis(benzene-1,3-dicarboxylate);ruthenium(4+) |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])c1.O=C([O-])c1cccc(C(=O)[O-])c1.[Ru+4] |
| InChI | InChI=1S/2C8H6O4.Ru/c2*9-7(10)5-2-1-3-6(4-5)8(11)12;/h2*1-4H,(H,9,10)(H,11,12);/q;;+4/p-4 |
| InChIKey | RCQJZYZGCVEPGJ-UHFFFAOYSA-J |
| XLogP | -3.18 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |