About calcium;3-carboxybenzoate;hydroxide
calcium;3-carboxybenzoate;hydroxide (PubChem CID 140685957) has the molecular formula C8H6CaO5
and a molecular weight of 222.21 g/mol. Its IUPAC name is calcium;3-carboxybenzoate;hydroxide.
Molecular Properties
| Compound Name | calcium;3-carboxybenzoate;hydroxide |
| PubChem CID | 140685957 |
| Molecular Formula | C8H6CaO5 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | calcium;3-carboxybenzoate;hydroxide |
| SMILES | O=C([O-])c1cccc(C(=O)O)c1.[Ca+2].[OH-] |
| InChI | InChI=1S/C8H6O4.Ca.H2O/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H2/q;+2;/p-2 |
| InChIKey | RNERRADWULVKLA-UHFFFAOYSA-L |
| XLogP | -0.81 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium;3-carboxybenzoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;3-carboxybenzoate;hydroxide?
The IUPAC name of calcium;3-carboxybenzoate;hydroxide (CID 140685957) is calcium;3-carboxybenzoate;hydroxide.
What is the SMILES notation for calcium;3-carboxybenzoate;hydroxide?
The canonical SMILES for calcium;3-carboxybenzoate;hydroxide is O=C([O-])c1cccc(C(=O)O)c1.[Ca+2].[OH-].
What is the InChIKey of calcium;3-carboxybenzoate;hydroxide?
The InChIKey is RNERRADWULVKLA-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.Ca.H2O/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H2/q;+2;/p-2.
What are the key properties of calcium;3-carboxybenzoate;hydroxide?
calcium;3-carboxybenzoate;hydroxide has a molecular weight of 222.21 g/mol, XLogP of -0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;3-carboxybenzoate;hydroxide is sourced from PubChem (CID 140685957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).