About sodium 3-phosphanylbenzoate
sodium 3-phosphanylbenzoate (PubChem CID 162334368) has the molecular formula C7H6NaO2P
and a molecular weight of 176.09 g/mol. Its IUPAC name is sodium 3-phosphanylbenzoate.
Molecular Properties
| Compound Name | sodium 3-phosphanylbenzoate |
| PubChem CID | 162334368 |
| Molecular Formula | C7H6NaO2P |
| Molecular Weight | 176.09 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | sodium 3-phosphanylbenzoate |
| SMILES | O=C([O-])c1cccc(P)c1.[Na+] |
| InChI | InChI=1S/C7H7O2P.Na/c8-7(9)5-2-1-3-6(10)4-5;/h1-4H,10H2,(H,8,9);/q;+1/p-1 |
| InChIKey | IWBCGQQASDCCCD-UHFFFAOYSA-M |
| XLogP | -3.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.09 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-phosphanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-phosphanylbenzoate?
The IUPAC name of sodium 3-phosphanylbenzoate (CID 162334368) is sodium 3-phosphanylbenzoate.
What is the SMILES notation for sodium 3-phosphanylbenzoate?
The canonical SMILES for sodium 3-phosphanylbenzoate is O=C([O-])c1cccc(P)c1.[Na+].
What is the InChIKey of sodium 3-phosphanylbenzoate?
The InChIKey is IWBCGQQASDCCCD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7O2P.Na/c8-7(9)5-2-1-3-6(10)4-5;/h1-4H,10H2,(H,8,9);/q;+1/p-1.
What are the key properties of sodium 3-phosphanylbenzoate?
sodium 3-phosphanylbenzoate has a molecular weight of 176.09 g/mol, XLogP of -3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-phosphanylbenzoate is sourced from PubChem (CID 162334368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).