About sodium 3-iodylbenzoate
sodium 3-iodylbenzoate (PubChem CID 102059154) has the molecular formula C7H4INaO4
and a molecular weight of 302.00 g/mol. Its IUPAC name is sodium 3-iodylbenzoate.
Molecular Properties
| Compound Name | sodium 3-iodylbenzoate |
| PubChem CID | 102059154 |
| Molecular Formula | C7H4INaO4 |
| Molecular Weight | 302.00 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | sodium 3-iodylbenzoate |
| SMILES | O=C([O-])c1cccc(I(=O)=O)c1.[Na+] |
| InChI | InChI=1S/C7H5IO4.Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H,9,10);/q;+1/p-1 |
| InChIKey | KOBNMAROZQECKT-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.00 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-iodylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-iodylbenzoate?
The IUPAC name of sodium 3-iodylbenzoate (CID 102059154) is sodium 3-iodylbenzoate.
What is the SMILES notation for sodium 3-iodylbenzoate?
The canonical SMILES for sodium 3-iodylbenzoate is O=C([O-])c1cccc(I(=O)=O)c1.[Na+].
What is the InChIKey of sodium 3-iodylbenzoate?
The InChIKey is KOBNMAROZQECKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5IO4.Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 3-iodylbenzoate?
sodium 3-iodylbenzoate has a molecular weight of 302.00 g/mol, XLogP of -2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-iodylbenzoate is sourced from PubChem (CID 102059154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).