C56H44O4P2 — CID 20544407
benzene-1,3-dicarboxylate;bis(tetraphenylphosphanium) (PubChem CID 20544407) has the molecular formula C56H44O4P2 and a molecular weight of 842.91 g/mol. Its IUPAC name is benzene-1,3-dicarboxylate;bis(tetraphenylphosphanium).
| Compound Name | benzene-1,3-dicarboxylate;bis(tetraphenylphosphanium) |
|---|---|
| PubChem CID | 20544407 |
| Molecular Formula | C56H44O4P2 |
| Molecular Weight | 842.91 g/mol |
| Exact Mass | 842.27 |
| IUPAC Name | benzene-1,3-dicarboxylate;bis(tetraphenylphosphanium) |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C24H20P.C8H6O4/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;9-7(10)5-2-1-3-6(4-5)8(11)12/h2*1-20H;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | UALRIXYIPWRMFX-UHFFFAOYSA-L |
| XLogP | 7.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.91 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|