About 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide
3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide (PubChem CID 171375740) has the molecular formula C26H21BrFO2P
and a molecular weight of 495.33 g/mol. Its IUPAC name is 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide.
Molecular Properties
| Compound Name | 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide |
| PubChem CID | 171375740 |
| Molecular Formula | C26H21BrFO2P |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide |
| SMILES | Br.O=C([O-])c1cccc(C(F)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H20FO2P.BrH/c27-25(20-11-10-12-21(19-20)26(28)29)30(22-13-4-1-5-14-22,23-15-6-2-7-16-23)24-17-8-3-9-18-24;/h1-19,25H;1H |
| InChIKey | REFVEFOREUTYBO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide?
The IUPAC name of 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide (CID 171375740) is 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide.
What is the SMILES notation for 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide?
The canonical SMILES for 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide is Br.O=C([O-])c1cccc(C(F)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide?
The InChIKey is REFVEFOREUTYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20FO2P.BrH/c27-25(20-11-10-12-21(19-20)26(28)29)30(22-13-4-1-5-14-22,23-15-6-2-7-16-23)24-17-8-3-9-18-24;/h1-19,25H;1H.
What are the key properties of 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide?
3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide has a molecular weight of 495.33 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[fluoro(triphenylphosphaniumyl)methyl]benzoate;hydrobromide is sourced from PubChem (CID 171375740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).