C12H6MgO4 — CID 67200509
magnesium naphthalene-2,6-dicarboxylate (PubChem CID 67200509) has the molecular formula C12H6MgO4 and a molecular weight of 238.48 g/mol. Its IUPAC name is magnesium naphthalene-2,6-dicarboxylate.
| Compound Name | magnesium naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 67200509 |
| Molecular Formula | C12H6MgO4 |
| Molecular Weight | 238.48 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | magnesium naphthalene-2,6-dicarboxylate |
| SMILES | O=C([O-])c1ccc2cc(C(=O)[O-])ccc2c1.[Mg+2] |
| InChI | InChI=1S/C12H8O4.Mg/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9;/h1-6H,(H,13,14)(H,15,16);/q;+2/p-2 |
| InChIKey | YHGHSCAWRYQCTJ-UHFFFAOYSA-L |
| XLogP | -0.81 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.48 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |