About anthracene-2-carboxylate
anthracene-2-carboxylate (PubChem CID 11160355) has the molecular formula C15H9O2-
and a molecular weight of 221.23 g/mol. Its IUPAC name is anthracene-2-carboxylate.
Molecular Properties
| Compound Name | anthracene-2-carboxylate |
| PubChem CID | 11160355 |
| Molecular Formula | C15H9O2- |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | anthracene-2-carboxylate |
| SMILES | O=C([O-])c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H10O2/c16-15(17)13-6-5-12-7-10-3-1-2-4-11(10)8-14(12)9-13/h1-9H,(H,16,17)/p-1 |
| InChIKey | RZRJYURCNBXIST-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-2-carboxylate?
The IUPAC name of anthracene-2-carboxylate (CID 11160355) is anthracene-2-carboxylate.
What is the SMILES notation for anthracene-2-carboxylate?
The canonical SMILES for anthracene-2-carboxylate is O=C([O-])c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene-2-carboxylate?
The InChIKey is RZRJYURCNBXIST-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H10O2/c16-15(17)13-6-5-12-7-10-3-1-2-4-11(10)8-14(12)9-13/h1-9H,(H,16,17)/p-1.
What are the key properties of anthracene-2-carboxylate?
anthracene-2-carboxylate has a molecular weight of 221.23 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-2-carboxylate is sourced from PubChem (CID 11160355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).