C16H8O4-2 — CID 86309851
anthracene-2,6-dicarboxylate (PubChem CID 86309851) has the molecular formula C16H8O4-2 and a molecular weight of 264.24 g/mol. Its IUPAC name is anthracene-2,6-dicarboxylate.
| Compound Name | anthracene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86309851 |
| Molecular Formula | C16H8O4-2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | anthracene-2,6-dicarboxylate |
| SMILES | O=C([O-])c1ccc2cc3cc(C(=O)[O-])ccc3cc2c1 |
| InChI | InChI=1S/C16H10O4/c17-15(18)11-3-1-9-5-14-8-12(16(19)20)4-2-10(14)6-13(9)7-11/h1-8H,(H,17,18)(H,19,20)/p-2 |
| InChIKey | XAAYMWLCUICVSL-UHFFFAOYSA-L |
| XLogP | 0.72 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|