potassium 6-methoxycarbonylnaphthalene-2-carboxylate

C13H9KO4 — CID 146050692

IUPACpotassium 6-methoxycarbonylnaphthalene-2-carboxylate
SMILESCOC(=O)c1ccc2cc(C(=O)[O-])ccc2c1.[K+]
InChIInChI=1S/C13H10O4.K/c1-17-13(16)11-5-3-8-6-10(12(14)15)4-2-9(8)7-11;/h2-7H,1H3,(H,14,15);/q;+1/p-1
InChIKeyULAHZGBWYSVSDP-UHFFFAOYSA-M
MW268.31 g/mol
LogP-2.01
Rot. Bonds2

About potassium 6-methoxycarbonylnaphthalene-2-carboxylate

potassium 6-methoxycarbonylnaphthalene-2-carboxylate (PubChem CID 146050692) has the molecular formula C13H9KO4 and a molecular weight of 268.31 g/mol. Its IUPAC name is potassium 6-methoxycarbonylnaphthalene-2-carboxylate.

Molecular Properties

Compound Namepotassium 6-methoxycarbonylnaphthalene-2-carboxylate
PubChem CID146050692
Molecular FormulaC13H9KO4
Molecular Weight268.31 g/mol
Exact Mass268.01
IUPAC Namepotassium 6-methoxycarbonylnaphthalene-2-carboxylate
SMILESCOC(=O)c1ccc2cc(C(=O)[O-])ccc2c1.[K+]
InChIInChI=1S/C13H10O4.K/c1-17-13(16)11-5-3-8-6-10(12(14)15)4-2-9(8)7-11;/h2-7H,1H3,(H,14,15);/q;+1/p-1
InChIKeyULAHZGBWYSVSDP-UHFFFAOYSA-M
XLogP-2.01
TPSA66.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 5-2.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze potassium 6-methoxycarbonylnaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 6-methoxycarbonylnaphthalene-2-carboxylate?
The IUPAC name of potassium 6-methoxycarbonylnaphthalene-2-carboxylate (CID 146050692) is potassium 6-methoxycarbonylnaphthalene-2-carboxylate.
What is the SMILES notation for potassium 6-methoxycarbonylnaphthalene-2-carboxylate?
The canonical SMILES for potassium 6-methoxycarbonylnaphthalene-2-carboxylate is COC(=O)c1ccc2cc(C(=O)[O-])ccc2c1.[K+].
What is the InChIKey of potassium 6-methoxycarbonylnaphthalene-2-carboxylate?
The InChIKey is ULAHZGBWYSVSDP-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10O4.K/c1-17-13(16)11-5-3-8-6-10(12(14)15)4-2-9(8)7-11;/h2-7H,1H3,(H,14,15);/q;+1/p-1.
What are the key properties of potassium 6-methoxycarbonylnaphthalene-2-carboxylate?
potassium 6-methoxycarbonylnaphthalene-2-carboxylate has a molecular weight of 268.31 g/mol, XLogP of -2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 6-methoxycarbonylnaphthalene-2-carboxylate is sourced from PubChem (CID 146050692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).