About anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium
anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium (PubChem CID 139190321) has the molecular formula C23H27NO2
and a molecular weight of 349.47 g/mol. Its IUPAC name is anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium.
Molecular Properties
| Compound Name | anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium |
| PubChem CID | 139190321 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium |
| SMILES | C[C@H]([NH3+])C1CCCCC1.O=C([O-])c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H10O2.C8H17N/c16-15(17)13-6-5-12-7-10-3-1-2-4-11(10)8-14(12)9-13;1-7(9)8-5-3-2-4-6-8/h1-9H,(H,16,17);7-8H,2-6,9H2,1H3/t;7-/m.0/s1 |
| InChIKey | UJLGXGTYSXRLRW-ZLTKDMPESA-N |
| XLogP | 3.55 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium?
The IUPAC name of anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium (CID 139190321) is anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium.
What is the SMILES notation for anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium?
The canonical SMILES for anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium is C[C@H]([NH3+])C1CCCCC1.O=C([O-])c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium?
The InChIKey is UJLGXGTYSXRLRW-ZLTKDMPESA-N. The full InChI is InChI=1S/C15H10O2.C8H17N/c16-15(17)13-6-5-12-7-10-3-1-2-4-11(10)8-14(12)9-13;1-7(9)8-5-3-2-4-6-8/h1-9H,(H,16,17);7-8H,2-6,9H2,1H3/t;7-/m.0/s1.
What are the key properties of anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium?
anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium has a molecular weight of 349.47 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-2-carboxylate;[(1S)-1-cyclohexylethyl]azanium is sourced from PubChem (CID 139190321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).