C34H26O4 — CID 102128962
[(2S,3S)-3-(anthracene-2-carbonyloxy)butan-2-yl] anthracene-2-carboxylate (PubChem CID 102128962) has the molecular formula C34H26O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is [(2S,3S)-3-(anthracene-2-carbonyloxy)butan-2-yl] anthracene-2-carboxylate.
| Compound Name | [(2S,3S)-3-(anthracene-2-carbonyloxy)butan-2-yl] anthracene-2-carboxylate |
|---|---|
| PubChem CID | 102128962 |
| Molecular Formula | C34H26O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [(2S,3S)-3-(anthracene-2-carbonyloxy)butan-2-yl] anthracene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2cc3ccccc3cc2c1)[C@H](C)OC(=O)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C34H26O4/c1-21(37-33(35)29-13-11-27-15-23-7-3-5-9-25(23)17-31(27)19-29)22(2)38-34(36)30-14-12-28-16-24-8-4-6-10-26(24)18-32(28)20-30/h3-22H,1-2H3/t21-,22-/m0/s1 |
| InChIKey | KOWNKFJKSCVSMG-VXKWHMMOSA-N |
| XLogP | 8.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|