About [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate
[(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate (PubChem CID 20724517) has the molecular formula C19H16O3
and a molecular weight of 292.33 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 20724517 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc2cc(O)ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C19H16O3/c1-13(14-5-3-2-4-6-14)22-19(21)17-8-7-16-12-18(20)10-9-15(16)11-17/h2-13,20H,1H3/t13-/m1/s1 |
| InChIKey | WEDNRHVVCFCWJU-CYBMUJFWSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate?
The IUPAC name of [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate (CID 20724517) is [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate is C[C@@H](OC(=O)c1ccc2cc(O)ccc2c1)c1ccccc1.
What is the InChIKey of [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate?
The InChIKey is WEDNRHVVCFCWJU-CYBMUJFWSA-N. The full InChI is InChI=1S/C19H16O3/c1-13(14-5-3-2-4-6-14)22-19(21)17-8-7-16-12-18(20)10-9-15(16)11-17/h2-13,20H,1H3/t13-/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate?
[(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate has a molecular weight of 292.33 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] 6-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 20724517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).