About 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate
1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate (PubChem CID 101338336) has the molecular formula C30H26N2O4
and a molecular weight of 478.55 g/mol. Its IUPAC name is 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate.
Molecular Properties
| Compound Name | 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate |
| PubChem CID | 101338336 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate |
| SMILES | CC(OC(=O)c1ccc(/N=N/c2ccc(C(=O)OC(C)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H26N2O4/c1-21(23-9-5-3-6-10-23)35-29(33)25-13-17-27(18-14-25)31-32-28-19-15-26(16-20-28)30(34)36-22(2)24-11-7-4-8-12-24/h3-22H,1-2H3/b32-31+ |
| InChIKey | WGQMGHAJWCJSAM-QNEJGDQOSA-N |
| XLogP | 7.94 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate?
The IUPAC name of 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate (CID 101338336) is 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate.
What is the SMILES notation for 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate?
The canonical SMILES for 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate is CC(OC(=O)c1ccc(/N=N/c2ccc(C(=O)OC(C)c3ccccc3)cc2)cc1)c1ccccc1.
What is the InChIKey of 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate?
The InChIKey is WGQMGHAJWCJSAM-QNEJGDQOSA-N. The full InChI is InChI=1S/C30H26N2O4/c1-21(23-9-5-3-6-10-23)35-29(33)25-13-17-27(18-14-25)31-32-28-19-15-26(16-20-28)30(34)36-22(2)24-11-7-4-8-12-24/h3-22H,1-2H3/b32-31+.
What are the key properties of 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate?
1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate has a molecular weight of 478.55 g/mol, XLogP of 7.94, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 4-[[4-(1-phenylethoxycarbonyl)phenyl]diazenyl]benzoate is sourced from PubChem (CID 101338336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).