C18H20O5 — CID 21191991
dipropan-2-yl 3-hydroxynaphthalene-2,7-dicarboxylate (PubChem CID 21191991) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is dipropan-2-yl 3-hydroxynaphthalene-2,7-dicarboxylate.
| Compound Name | dipropan-2-yl 3-hydroxynaphthalene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 21191991 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dipropan-2-yl 3-hydroxynaphthalene-2,7-dicarboxylate |
| SMILES | CC(C)OC(=O)c1ccc2cc(O)c(C(=O)OC(C)C)cc2c1 |
| InChI | InChI=1S/C18H20O5/c1-10(2)22-17(20)13-6-5-12-9-16(19)15(8-14(12)7-13)18(21)23-11(3)4/h5-11,19H,1-4H3 |
| InChIKey | MJKSOSMTRPQXES-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |