About tetracene-2-carboxamide;hydrobromide
tetracene-2-carboxamide;hydrobromide (PubChem CID 22400124) has the molecular formula C19H14BrNO
and a molecular weight of 352.23 g/mol. Its IUPAC name is tetracene-2-carboxamide;hydrobromide.
Molecular Properties
| Compound Name | tetracene-2-carboxamide;hydrobromide |
| PubChem CID | 22400124 |
| Molecular Formula | C19H14BrNO |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | tetracene-2-carboxamide;hydrobromide |
| SMILES | Br.NC(=O)c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C19H13NO.BrH/c20-19(21)15-6-5-14-9-17-7-12-3-1-2-4-13(12)8-18(17)11-16(14)10-15;/h1-11H,(H2,20,21);1H |
| InChIKey | ORNIMIHNKOKLFT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tetracene-2-carboxamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracene-2-carboxamide;hydrobromide?
The IUPAC name of tetracene-2-carboxamide;hydrobromide (CID 22400124) is tetracene-2-carboxamide;hydrobromide.
What is the SMILES notation for tetracene-2-carboxamide;hydrobromide?
The canonical SMILES for tetracene-2-carboxamide;hydrobromide is Br.NC(=O)c1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of tetracene-2-carboxamide;hydrobromide?
The InChIKey is ORNIMIHNKOKLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO.BrH/c20-19(21)15-6-5-14-9-17-7-12-3-1-2-4-13(12)8-18(17)11-16(14)10-15;/h1-11H,(H2,20,21);1H.
What are the key properties of tetracene-2-carboxamide;hydrobromide?
tetracene-2-carboxamide;hydrobromide has a molecular weight of 352.23 g/mol, XLogP of 4.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracene-2-carboxamide;hydrobromide is sourced from PubChem (CID 22400124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).