C15H18N2O3 — CID 91265869
3-hydroxynaphthalene-2,7-dicarboxamide;propane (PubChem CID 91265869) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-hydroxynaphthalene-2,7-dicarboxamide;propane.
| Compound Name | 3-hydroxynaphthalene-2,7-dicarboxamide;propane |
|---|---|
| PubChem CID | 91265869 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-hydroxynaphthalene-2,7-dicarboxamide;propane |
| SMILES | CCC.NC(=O)c1ccc2cc(O)c(C(N)=O)cc2c1 |
| InChI | InChI=1S/C12H10N2O3.C3H8/c13-11(16)7-2-1-6-5-10(15)9(12(14)17)4-8(6)3-7;1-3-2/h1-5,15H,(H2,13,16)(H2,14,17);3H2,1-2H3 |
| InChIKey | MCXCCFOFBHZVHL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |