C18H22N2O2 — CID 141060684
1-hexylnaphthalene-2,6-dicarboxamide (PubChem CID 141060684) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-hexylnaphthalene-2,6-dicarboxamide.
| Compound Name | 1-hexylnaphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 141060684 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-hexylnaphthalene-2,6-dicarboxamide |
| SMILES | CCCCCCc1c(C(N)=O)ccc2cc(C(N)=O)ccc12 |
| InChI | InChI=1S/C18H22N2O2/c1-2-3-4-5-6-15-14-9-8-13(17(19)21)11-12(14)7-10-16(15)18(20)22/h7-11H,2-6H2,1H3,(H2,19,21)(H2,20,22) |
| InChIKey | NIXHRRVOMPDYQT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|