C18H28N2O2 — CID 141297186
2-decylbenzene-1,4-dicarboxamide (PubChem CID 141297186) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-decylbenzene-1,4-dicarboxamide.
| Compound Name | 2-decylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 141297186 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-decylbenzene-1,4-dicarboxamide |
| SMILES | CCCCCCCCCCc1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C18H28N2O2/c1-2-3-4-5-6-7-8-9-10-14-13-15(17(19)21)11-12-16(14)18(20)22/h11-13H,2-10H2,1H3,(H2,19,21)(H2,20,22) |
| InChIKey | USQCIJZVDUZBFI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|