C20H30N4O4 — CID 175294645
3-decylbenzene-1,2,4,5-tetracarboxamide (PubChem CID 175294645) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-decylbenzene-1,2,4,5-tetracarboxamide.
| Compound Name | 3-decylbenzene-1,2,4,5-tetracarboxamide |
|---|---|
| PubChem CID | 175294645 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-decylbenzene-1,2,4,5-tetracarboxamide |
| SMILES | CCCCCCCCCCc1c(C(N)=O)c(C(N)=O)cc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C20H30N4O4/c1-2-3-4-5-6-7-8-9-10-12-15(19(23)27)13(17(21)25)11-14(18(22)26)16(12)20(24)28/h11H,2-10H2,1H3,(H2,21,25)(H2,22,26)(H2,23,27)(H2,24,28) |
| InChIKey | CKCFTTAFYNRNBJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|