C16H24N2O2 — CID 175393546
3,4-dibutylbenzene-1,2-dicarboxamide (PubChem CID 175393546) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3,4-dibutylbenzene-1,2-dicarboxamide.
| Compound Name | 3,4-dibutylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 175393546 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3,4-dibutylbenzene-1,2-dicarboxamide |
| SMILES | CCCCc1ccc(C(N)=O)c(C(N)=O)c1CCCC |
| InChI | InChI=1S/C16H24N2O2/c1-3-5-7-11-9-10-13(15(17)19)14(16(18)20)12(11)8-6-4-2/h9-10H,3-8H2,1-2H3,(H2,17,19)(H2,18,20) |
| InChIKey | RUOVDJISQVGMKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |