C16H26N4O2 — CID 19913242
2,4-bis(4-aminobutyl)benzene-1,3-dicarboxamide (PubChem CID 19913242) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,4-bis(4-aminobutyl)benzene-1,3-dicarboxamide.
| Compound Name | 2,4-bis(4-aminobutyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19913242 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2,4-bis(4-aminobutyl)benzene-1,3-dicarboxamide |
| SMILES | NCCCCc1ccc(C(N)=O)c(CCCCN)c1C(N)=O |
| InChI | InChI=1S/C16H26N4O2/c17-9-3-1-5-11-7-8-13(15(19)21)12(6-2-4-10-18)14(11)16(20)22/h7-8H,1-6,9-10,17-18H2,(H2,19,21)(H2,20,22) |
| InChIKey | JWSHGFKHFXIPEJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|