C20H32FeO — CID 70631281
iron;1-(2,3,4-tributylphenyl)ethanone (PubChem CID 70631281) has the molecular formula C20H32FeO and a molecular weight of 344.32 g/mol. Its IUPAC name is iron;1-(2,3,4-tributylphenyl)ethanone.
| Compound Name | iron;1-(2,3,4-tributylphenyl)ethanone |
|---|---|
| PubChem CID | 70631281 |
| Molecular Formula | C20H32FeO |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | iron;1-(2,3,4-tributylphenyl)ethanone |
| SMILES | CCCCc1ccc(C(C)=O)c(CCCC)c1CCCC.[Fe] |
| InChI | InChI=1S/C20H32O.Fe/c1-5-8-11-17-14-15-18(16(4)21)20(13-10-7-3)19(17)12-9-6-2;/h14-15H,5-13H2,1-4H3; |
| InChIKey | DRBFHCSRHISQHK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|