3,4-dibutylphthalic acid;silicic acid

C16H26O8Si — CID 67175411

IUPAC3,4-dibutylphthalic acid;silicic acid
SMILESCCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC.O[Si](O)(O)O
InChIInChI=1S/C16H22O4.H4O4Si/c1-3-5-7-11-9-10-13(15(17)18)14(16(19)20)12(11)8-6-4-2;1-5(2,3)4/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20);1-4H
InChIKeyFSAZKZNOAODAOI-UHFFFAOYSA-N
MW374.46 g/mol
LogP1.16
Rot. Bonds8

About 3,4-dibutylphthalic acid;silicic acid

3,4-dibutylphthalic acid;silicic acid (PubChem CID 67175411) has the molecular formula C16H26O8Si and a molecular weight of 374.46 g/mol. Its IUPAC name is 3,4-dibutylphthalic acid;silicic acid.

Molecular Properties

Compound Name3,4-dibutylphthalic acid;silicic acid
PubChem CID67175411
Molecular FormulaC16H26O8Si
Molecular Weight374.46 g/mol
Exact Mass374.14
IUPAC Name3,4-dibutylphthalic acid;silicic acid
SMILESCCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC.O[Si](O)(O)O
InChIInChI=1S/C16H22O4.H4O4Si/c1-3-5-7-11-9-10-13(15(17)18)14(16(19)20)12(11)8-6-4-2;1-5(2,3)4/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20);1-4H
InChIKeyFSAZKZNOAODAOI-UHFFFAOYSA-N
XLogP1.16
TPSA155.52 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.46
LogP ≤ 51.16
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 3,4-dibutylphthalic acid;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dibutylphthalic acid;silicic acid?
The IUPAC name of 3,4-dibutylphthalic acid;silicic acid (CID 67175411) is 3,4-dibutylphthalic acid;silicic acid.
What is the SMILES notation for 3,4-dibutylphthalic acid;silicic acid?
The canonical SMILES for 3,4-dibutylphthalic acid;silicic acid is CCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC.O[Si](O)(O)O.
What is the InChIKey of 3,4-dibutylphthalic acid;silicic acid?
The InChIKey is FSAZKZNOAODAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4.H4O4Si/c1-3-5-7-11-9-10-13(15(17)18)14(16(19)20)12(11)8-6-4-2;1-5(2,3)4/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20);1-4H.
What are the key properties of 3,4-dibutylphthalic acid;silicic acid?
3,4-dibutylphthalic acid;silicic acid has a molecular weight of 374.46 g/mol, XLogP of 1.16, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutylphthalic acid;silicic acid is sourced from PubChem (CID 67175411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).