C16H26O8Si — CID 67175411
3,4-dibutylphthalic acid;silicic acid (PubChem CID 67175411) has the molecular formula C16H26O8Si and a molecular weight of 374.46 g/mol. Its IUPAC name is 3,4-dibutylphthalic acid;silicic acid.
| Compound Name | 3,4-dibutylphthalic acid;silicic acid |
|---|---|
| PubChem CID | 67175411 |
| Molecular Formula | C16H26O8Si |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3,4-dibutylphthalic acid;silicic acid |
| SMILES | CCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCC.O[Si](O)(O)O |
| InChI | InChI=1S/C16H22O4.H4O4Si/c1-3-5-7-11-9-10-13(15(17)18)14(16(19)20)12(11)8-6-4-2;1-5(2,3)4/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20);1-4H |
| InChIKey | FSAZKZNOAODAOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|