C34H47NO4 — CID 174789730
3,4-dioctylphthalic acid;2-methylquinoline (PubChem CID 174789730) has the molecular formula C34H47NO4 and a molecular weight of 533.75 g/mol. Its IUPAC name is 3,4-dioctylphthalic acid;2-methylquinoline.
| Compound Name | 3,4-dioctylphthalic acid;2-methylquinoline |
|---|---|
| PubChem CID | 174789730 |
| Molecular Formula | C34H47NO4 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | 3,4-dioctylphthalic acid;2-methylquinoline |
| SMILES | CCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCCCCCC.Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H38O4.C10H9N/c1-3-5-7-9-11-13-15-19-17-18-21(23(25)26)22(24(27)28)20(19)16-14-12-10-8-6-4-2;1-8-6-7-9-4-2-3-5-10(9)11-8/h17-18H,3-16H2,1-2H3,(H,25,26)(H,27,28);2-7H,1H3 |
| InChIKey | IIJDJTWBURBDTC-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|