C56H92O8 — CID 161379743
didecyl benzene-1,2-dicarboxylate;3,4-didecylphthalic acid (PubChem CID 161379743) has the molecular formula C56H92O8 and a molecular weight of 893.34 g/mol. Its IUPAC name is didecyl benzene-1,2-dicarboxylate;3,4-didecylphthalic acid.
| Compound Name | didecyl benzene-1,2-dicarboxylate;3,4-didecylphthalic acid |
|---|---|
| PubChem CID | 161379743 |
| Molecular Formula | C56H92O8 |
| Molecular Weight | 893.34 g/mol |
| Exact Mass | 892.68 |
| IUPAC Name | didecyl benzene-1,2-dicarboxylate;3,4-didecylphthalic acid |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC.CCCCCCCCCCc1ccc(C(=O)O)c(C(=O)O)c1CCCCCCCCCC |
| InChI | InChI=1S/2C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2;1-3-5-7-9-11-13-15-17-19-23-21-22-25(27(29)30)26(28(31)32)24(23)20-18-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3;21-22H,3-20H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | VROJUDDCCJCEKH-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.34 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|